Content deleted Content added
GoingBatty (talk | contribs) General fixes, added orphan tag using AWB (7424) |
The chemistds (talk | contribs) Added CSID, (std)InChI, and (std)InChIkey |
||
| Line 10: | Line 10: | ||
| PubChem = |
| PubChem = |
||
| SMILES = O=C2N([N](=O)=O)C3C(N2[N](=O)=O)N([N](=O)=O)C1C(N3[N](=O)=O)N([N](=O)=O)C(=O)N1[N](=O)=O |
| SMILES = O=C2N([N](=O)=O)C3C(N2[N](=O)=O)N([N](=O)=O)C1C(N3[N](=O)=O)N([N](=O)=O)C(=O)N1[N](=O)=O |
||
| ChemSpiderID = 23078717 |
|||
| StdInChI = 1S/C6H4N12O14/c19-5-9(15(25)26)1-2(10(5)16(27)28)8(14(23)24)4-3(7(1)13(21)22)11(17(29)30)6(20)12(4)18(31)32/h1-4H |
|||
| InChI=1/C6H4N12O14/c19-5-9(15(25)26)1-2(10(5)16(27)28)8(14(23)24)4-3(7(1)13(21)22)11(17(29)30)6(20)12(4)18(31)32/h1-4H |
|||
| InChIKey = ZFBXJPJQJKATGM-UHFFFAOYAE |
|||
| StdInChIKey = ZFBXJPJQJKATGM-UHFFFAOYSA-N |
|||
}} |
}} |
||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
Revision as of 00:36, 29 November 2010
| |
| Names | |
|---|---|
| IUPAC name
2,6-dioxo-1,3,4,5,7,8-hexanitrodecahydro-1H,5H-diimidazo[4,5-b:4',5'-e]pyrazine
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C6H4N12O14 | |
| Molar mass | 468.168 |
| Explosive data | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
HHTDD is a powerful but moisture sensitive explosive compound. It is essentially an open analogue of the cyclic nitroamine cage compounds such as CL-20. While it is highly explosive, with a velocity of detonation even higher than that of CL-20, HHTDD readily decomposes in the presence of even trace amounts of water, making it unsuitable for any practical applications.[1]
References
- ^ Murugappa Vedachalam, Vayalakkavoor T. Ramakrishnan, Joseph H. Boyer, Ian J. Dagley, Keith A. Nelson, Horst G. Adolph, Richard Gilardi, Clifford George, Judith L. Flippen-Anderson. Facile synthesis and nitration of cis-syn-cis-2,6-dioxodecahydro-1H,5H-diimidazo[4,5-b:4',5'-e]pyrazine. Journal of Organic Chemistry. May 1991; 56(10):3413-3419. doi 10.1021/jo00010a043