Trichome

Content deleted Content added
RjwilmsiBot (talk | contribs)
m Per WP:ISBN formatted 1 ISBNs using AWB (7596)
Citation bot (talk | contribs)
Removed parameters. | Use this bot. Report bugs. | Suggested by Abductive | Category:Restricted titles | #UCB_Category 460/828
 
(26 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{correct title|reason=bracket|Benzo[''a'']fluorene}}
{{DISPLAYTITLE:Benzo(''a'')fluorene}}
{{correct title|reason=bracket|edit=substitution|Benzo[''a'']fluorene}}
{{chembox
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 399537629
| verifiedrevid = 399537629
| Name = Benzo[''a'']fluorene
| Name = Benzo[''a'']fluorene
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Benzo(a)fluorene.png
| ImageFile = Benzo(a)fluorene.png
| ImageAlt = Chemical structure of benzo[a]fluorene
| ImageSize = 200px
| ImageName = Chemical structure of benzo[a]fluorene
| ImageFile1 = Benzo(a)fluorene-3D-balls.png
| IUPACName = 11''H''-Benzo[''a'']fluorene
| ImageAlt1 = Ball-and-stick model of the benzo[a]fluorene molecule
| PIN = 11''H''-Benzo[''a'']fluorene
| OtherNames = 2,3-Benzopyrene
| OtherNames = 2,3-Benzopyrene<br>Tetracyclo[8.7.0.0<sup>2,7</sup>.0<sup>11,16</sup>]heptadeca-1,3,5,7,9,11,13,15-octaene{{citation needed|date=May 2019}}
| Reference = <ref name="hand">
| Reference = <ref name="hand">
{{Citation
{{Citation
| last = Lide
| last = Lide
| first = David R.
| first = David R.
| author-link =
| author-link =
| last2 =
| first2 =
| author2-link =
| publication-date =
| publication-date =
| date =
| year = 1998
| year = 1998
| title = Handbook of Chemistry and Physics
| title = Handbook of Chemistry and Physics
| edition = 87
| edition = 87
| volume =
| volume =
| series =
| series =
| publication-place = Boca Raton, FL
| publication-place = Boca Raton, Florida
| place =
| place =
| publisher = CRC Press
| publisher = CRC Press
| id =
| id =
Line 31: Line 33:
| oclc =
| oclc =
| pages = 3-42, 8-119
| pages = 3-42, 8-119
| url =
| url =
| accessdate =
| accessdate =
}}</ref>
}}</ref>
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8840
| ChemSpiderID = 8840
Line 45: Line 47:
| StdInChIKey = HKMTVMBEALTRRR-UHFFFAOYSA-N
| StdInChIKey = HKMTVMBEALTRRR-UHFFFAOYSA-N
| CASNo = 238-84-6
| CASNo = 238-84-6
| CASNo_Ref =
| CASNo_Ref = {{cascite|correct|??}}
| RTECS =
| RTECS = DF6382000
| EINECS =
| EINECS = 205-944-9
| PubChem =
| PubChem = 9195
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C19343
| UNII = 65EP6ZT62K
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = C<sub>17</sub>H<sub>12</sub>
| Formula = C<sub>17</sub>H<sub>12</sub>
| MolarMass = 216.277 g/mol
| MolarMass = 216.277 g/mol
| Appearance =
| Appearance =
| Density = 0.819 g/cm<sup>3</sup>
| Density = 0.819 g/cm<sup>3</sup>
| Solubility = 0.000045 g/L
| Solubility = 0.000045 g/L
| SolubleOther = soluble in [[diethyl ether]], [[benzene]], [[chloroform]]
| SolubleOther = soluble in [[diethyl ether]], [[benzene]], [[chloroform]]
| MeltingPt = 189.5°C
| MeltingPtC = 189.5
| MeltingPt_notes =
| BoilingPt = 405°C
| VaporPressure =
| BoilingPtC = 405
| BoilingPt_notes =
| VaporPressure =
}}
}}
| Section3 = {{Chembox Structure
|Section3={{Chembox Structure
| Coordination =
| Coordination =
| CrystalStruct =
| CrystalStruct =
}}
}}
| Section4 = {{Chembox Thermochemistry
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHf =
| DeltaHc =
| DeltaHc =
| Entropy =
| Entropy =
| HeatCapacity =
| HeatCapacity =
}}
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| ExternalMSDS =
| ExternalSDS =
| EUIndex =
| NFPA-H =
| NFPA-H =
| NFPA-F =
| NFPA-F =
| NFPA-R =
| NFPA-R =
| RPhrases =
| FlashPt =
| SPhrases =
| AutoignitionPt =
| FlashPt =
| ExploLimits =
| Autoignition =
| LD50 =
| ExploLimits =
| LD50 =
}}
}}
| Section8 = {{Chembox Related
|Section8={{Chembox Related
| OtherCpds =
| OtherCompounds =
}}
}}
}}
}}


'''Benzo[''a'']fluorene''' ([[IUPAC]] name, '''11''H''-Benzo[''a'']fluorene''') is a [[polycyclic aromatic hydrocarbon]] (PAH). It is currently listed as a [[List of IARC Group 3 carcinogens|Group 3 carcinogen by the IARC]].<ref>{{cite web |url= http://www.inchem.org/documents/iarc/vol32/benzo%5Ba%5Dfluorene.html|title= Benzo(a)fluorene (IARC Summary & Evaluation, Volume 32, 1983)|author= |date=17 April 1998 |work= |publisher= IARC|accessdate=22 July 2010}}</ref>
'''Benzo[''a'']fluorene''' ([[IUPAC]] name, '''11''H''-benzo[''a'']fluorene''') is a [[polycyclic aromatic hydrocarbon]] (PAH). It is currently listed as a [[List of IARC Group 3 carcinogens|Group 3 carcinogen by the IARC]].<ref>{{cite web |url= http://www.inchem.org/documents/iarc/vol32/benzo%5Ba%5Dfluorene.html|title= Benzo(a)fluorene (IARC Summary & Evaluation, Volume 32, 1983)|author= |date=17 April 1998 |publisher= IARC|accessdate=22 July 2010}}</ref>

==See also==
* [[Benzo(c)fluorene|Benzo[c]fluorene]]
* [[Benzofluorene]]


== References ==
== References ==
Line 95: Line 103:


{{PAHs}}
{{PAHs}}
{{Use dmy dates|date=March 2018}}
{{hydrocarbon-stub}}

[[Category:IARC Group 3 carcinogens]]
[[Category:IARC Group 3 carcinogens]]
[[Category:Polycyclic aromatic hydrocarbons]]
[[Category:Polycyclic aromatic hydrocarbons]]
[[Category:Tetracyclic compounds]]



[[fr:Benzo(a)fluorène]]
{{hydrocarbon-stub}}

Latest revision as of 13:00, 16 March 2023

Benzo[a]fluorene[1]
Chemical structure of benzo[a]fluorene
Ball-and-stick model of the benzo[a]fluorene molecule
Names
Preferred IUPAC name
11H-Benzo[a]fluorene
Other names
2,3-Benzopyrene
Tetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene[citation needed]
Identifiers
3D model (JSmol)
ChemSpider
ECHA InfoCard 100.005.405 Edit this at Wikidata
EC Number
  • 205-944-9
KEGG
RTECS number
  • DF6382000
UNII
  • InChI=1S/C17H12/c1-3-7-14-12(5-1)9-10-16-15-8-4-2-6-13(15)11-17(14)16/h1-10H,11H2 checkY
    Key: HKMTVMBEALTRRR-UHFFFAOYSA-N checkY
  • InChI=1/C17H12/c1-3-7-14-12(5-1)9-10-16-15-8-4-2-6-13(15)11-17(14)16/h1-10H,11H2
    Key: HKMTVMBEALTRRR-UHFFFAOYAQ
  • c4ccc3c2c(c1c(cccc1)C2)ccc3c4
Properties
C17H12
Molar mass 216.277 g/mol
Density 0.819 g/cm3
Melting point 189.5 °C (373.1 °F; 462.6 K)
Boiling point 405 °C (761 °F; 678 K)
0.000045 g/L
Solubility soluble in diethyl ether, benzene, chloroform
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is checkY☒N ?)

Benzo[a]fluorene (IUPAC name, 11H-benzo[a]fluorene) is a polycyclic aromatic hydrocarbon (PAH). It is currently listed as a Group 3 carcinogen by the IARC.[2]

See also[edit]

References[edit]

  1. ^ Lide, David R. (1998), Handbook of Chemistry and Physics (87 ed.), Boca Raton, Florida: CRC Press, pp. 3–42, 8–119, ISBN 0-8493-0594-2
  2. ^ "Benzo(a)fluorene (IARC Summary & Evaluation, Volume 32, 1983)". IARC. 17 April 1998. Retrieved 22 July 2010.


Leave a Reply