Anisoyl chloride

Anisoyl chloride
Names
Other names Methoxybenzoyl chloride
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	21106136 Y
InChI InChI=1S/C8H7ClO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 Y Key: MXMOTZIXVICDSD-UHFFFAOYSA-N Y InChI=1/C8H7ClO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 Key: MXMOTZIXVICDSD-UHFFFAOYAC
SMILES COc1ccc(cc1)C(Cl)=O
Properties
Chemical formula	C8H7ClO2
Molar mass	170.59 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Y verify (what is YN ?) Infobox references

Anisoyl chloride (also called methoxybenzoyl chloride) is an acyl halide, specifically an aromatic acyl chloride, and may be formed from anisic acid by replacing a hydroxyl group with a chloride group. There are three isomers, the ortho-, meta-, and para- forms.

References