Trichome

Content deleted Content added
better line drawing and minor edits
DePiep (talk | contribs)
m Chembox: rm/replace deprecated params. Fix unknown parameters (via AWB script)
Line 2: Line 2:
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 443387206
| verifiedrevid = 443387206
| Name = Ammonium hexachloroplatinate
| Name = Ammonium hexachloroplatinate
| ImageFile = NH4 2PtCl6improved.svg
| ImageFile = NH4 2PtCl6improved.svg
| ImageSize = 200px
| ImageSize = 200px
| ImageName = Ammonium hexachloroplatinate
| ImageName = Ammonium hexachloroplatinate
| ImageFile2 = (NH4)2PtCl6Xray.tif
| ImageFile2 = (NH4)2PtCl6Xray.tif
| ImageSize2 = 320px
| ImageSize2 = 320px
| ImageName2 = Ammonium hexachloroplatinate
| ImageName2 = Ammonium hexachloroplatinate
| IUPACName = Ammonium hexachloroplatinate(IV)
| IUPACName = Ammonium hexachloroplatinate(IV)
| OtherNames = ammonium chloroplatinate
| OtherNames = ammonium chloroplatinate
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10628022
| ChemSpiderID = 10628022
| InChI = 1/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4/rCl6Pt.2H3N/c1-7(2,3,4,5)6;;/h;2*1H3/q-2;;/p+2
| InChI = 1/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4/rCl6Pt.2H3N/c1-7(2,3,4,5)6;;/h;2*1H3/q-2;;/p+2
Line 26: Line 26:
| CASNo = 16919-58-7
| CASNo = 16919-58-7
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = (NH<sub>4</sub>)<sub>2</sub>PtCl<sub>6</sub>
| Formula = (NH<sub>4</sub>)<sub>2</sub>PtCl<sub>6</sub>
| MolarMass = 443.87 g/mol
| MolarMass = 443.87 g/mol
| Odor = odorless
| Odor = odorless
| Appearance = yellow crystals
| Appearance = yellow crystals
| Density = 3.065 g/cm<sup>3</sup>
| Density = 3.065 g/cm<sup>3</sup>
| MeltingPtC = 380
| MeltingPtC = 380
| Melting_notes = decomposes
| MeltingPt_notes = decomposes
| Solubility = 0.289 g/100ml (0 °C)<br /> 0.7 g/100ml (15 °C)<ref>{{cite web|url=http://chemister.ru/Database/properties-en.php?dbid=1&id=7145 |title=ammonium hexachloroplatinate(IV) |publisher=Chemister.ru |date=2007-03-19 |accessdate=2014-06-03}}</ref><br /> 0.499 g/100ml (20 °C)<br /> 3.36 g/100ml (100 °C)}}
| Solubility = 0.289 g/100ml (0 °C)<br /> 0.7 g/100ml (15 °C)<ref>{{cite web|url=http://chemister.ru/Database/properties-en.php?dbid=1&id=7145 |title=ammonium hexachloroplatinate(IV) |publisher=Chemister.ru |date=2007-03-19 |accessdate=2014-06-03}}</ref><br /> 0.499 g/100ml (20 °C)<br /> 3.36 g/100ml (100 °C)}}
}}
}}



Revision as of 00:40, 15 July 2015

Ammonium hexachloroplatinate
Ammonium hexachloroplatinate
Ammonium hexachloroplatinate
Names
IUPAC name
Ammonium hexachloroplatinate(IV)
Other names
ammonium chloroplatinate
Identifiers
3D model (JSmol)
ChEBI
ChemSpider
ECHA InfoCard 100.037.233 Edit this at Wikidata
  • InChI=1S/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4 checkY
    Key: PCCGQTHFYHJATL-UHFFFAOYSA-J checkY
  • InChI=1/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4/rCl6Pt.2H3N/c1-7(2,3,4,5)6;;/h;2*1H3/q-2;;/p+2
    Key: PCCGQTHFYHJATL-WPAIPAOFAY
  • [NH4+].[NH4+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl
Properties
(NH4)2PtCl6
Molar mass 443.87 g/mol
Appearance yellow crystals
Odor odorless
Density 3.065 g/cm3
Melting point 380 °C (716 °F; 653 K) decomposes
0.289 g/100ml (0 °C)
0.7 g/100ml (15 °C)[1]
0.499 g/100ml (20 °C)
3.36 g/100ml (100 °C)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
checkY verify (what is checkY☒N ?)

Ammonium hexachloroplatinate, also known as ammonium chloroplatinate, is the inorganic compound with the formula (NH4)2[PtCl6]. It is a rare example of a soluble platinum(IV) salt that is not hygroscopic. It forms intensely yellow solutions in water. In the presence of 1M NH4Cl, its solubility is only 0.0028 g/100 mL.

Preparation and structure

The compound consists of separate tetrahedral ammonium cations and octahedral [PtCl6]2− anions. It is usually generated as a fine yellow precipitate by treating a solution of hexachloroplatinic acid with a solution of an ammonium salt.[2] The complex is so poorly soluble that this step is employed in the isolation of platinum from ores and recycled residues.[3]

As analyzed by X-ray crystallography, the salt crystallizes in a cubic motif. The [PtCl6]2- centers are octahedral. The NH4+ centers are hydrogen bonded to the chloride ligands.[4]

Uses and reactions

Ammonium hexachloroplatinate is used in platinum plating. Heating (NH4)2[PtCl6] under a stream of hydrogen at 200 °C produces platinum sponge. Treating this with chlorine gives H2PtCl6.[2]

References

  1. ^ "ammonium hexachloroplatinate(IV)". Chemister.ru. 2007-03-19. Retrieved 2014-06-03.
  2. ^ a b George B. Kauffman (1967). "Ammonium Hexachloroplatinate(IV)". Inorganic Syntheses. Inorganic Syntheses. 9: 182–185. doi:10.1002/9780470132401.ch51. ISBN 978-0-470-13240-1.
  3. ^ Cotton, S. A. Chemistry of Precious Metals, Chapman and Hall (London): 1997. ISBN 0-7514-0413-6.
  4. ^ Verde-Gómez, Y.; Alonso-Nuñez, G.; Cervantes, F.; Keer, A. "Aqueous solution reaction to synthesize ammonium hexachloroplatinate and its crystallogrpahic and thermogravimetric characterization" Materials Letters, 2003, volume 57, p 4667-4672. doi:10.1016/S0167-577X(03)00381-1

Leave a Reply