Content deleted Content added
حسن علي البط (talk | contribs) m Adding category Category:Organochlorides (using HotCat) |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID InChI InChIKey SMILES1. |
||
| Line 7: | Line 7: | ||
|OtherNames= |
|OtherNames= |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| ChemSpiderID = 2037 |
|||
| ⚫ | |||
| InChI = 1/C11H14ClN3O4S3/c1-2-3-20-6-11-14-8-4-7(12)9(21(13,16)17)5-10(8)22(18,19)15-11/h2,4-5,11,14-15H,1,3,6H2,(H2,13,16,17) |
|||
| InChIKey = VGLGVJVUHYTIIU-UHFFFAOYAS |
|||
| SMILES1 = O=S(=O)(c1c(Cl)cc2c(c1)S(=O)(=O)NC(N2)CSC\C=C)N |
|||
| ⚫ | |||
| PubChem=2122 |
| PubChem=2122 |
||
| SMILES=C=CCSCC1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |
| SMILES=C=CCSCC1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |
||
Revision as of 11:08, 8 November 2010
| |
| Names | |
|---|---|
| IUPAC name
(3R)-6-chloro-1,1-dioxo-3-(prop-2-enylsulfanylmethyl)-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-sulfonamide
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
| ECHA InfoCard | 100.024.541 |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C11H14ClN3O4S3 | |
| Molar mass | 383.89456 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Altizide is a diuretic.