Content deleted Content added
m pt: |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID InChI InChIKey SMILES1. |
||
Line 6: | Line 6: | ||
|OtherNames= |
|OtherNames= |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| ChemSpiderID = 42 |
|||
⚫ | |||
| InChI = 1/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10) |
|||
| InChIKey = HWXBTNAVRSUOJR-UHFFFAOYAI |
|||
| SMILES1 = O=C(O)C(O)CCC(=O)O |
|||
⚫ | |||
| PubChem=43 |
| PubChem=43 |
||
| SMILES=C(CC(=O)O)C(C(=O)O)O |
| SMILES=C(CC(=O)O)C(C(=O)O)O |
Revision as of 10:55, 8 November 2010
Names | |
---|---|
IUPAC name
2-Hydroxypentanedioic acid
| |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
MeSH | Alpha-hydroxyglutarate |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C5H8O5 | |
Molar mass | 148.11 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
alpha-Hydroxyglutaric acid is a alpha hydroxy acid.
alpha-Hydroxyglutaric acid (2-hydroxyglutaric acid) is an alpha hydroxy acid. In humans the compound is formed by a Hydroxyacid-oxoacid transhydrogenase whereas in bacteria is formed by a 2-hydroxyglutarate synthase. The compound can be converted to alpha-Ketoglutaric acid through the action of a 2-hydroxyglutarate dehydrogenase which, in humans, are two enzymes called D2HGDH and L2HGDH. Deficiency in either of these two enzymes lead to a disease known as 2-Hydroxyglutaric aciduria.