Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: StdInChI StdInChIKey SMILES1. |
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi |
||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| verifiedrevid = |
| verifiedrevid = 399519652 |
||
| ImageFile = Ammonium sulfite.svg |
| ImageFile = Ammonium sulfite.svg |
||
| ImageSize = 200px |
| ImageSize = 200px |
||
| Line 6: | Line 6: | ||
| OtherNames = |
| OtherNames = |
||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| |
| UNII = |
||
| InChI = |
| InChI = |
||
| SMILES = [H][N+]([H])([H])[H].[H][N+]([H])([H])[H].O=S([O-])[O-] |
| SMILES = [H][N+]([H])([H])[H].[H][N+]([H])([H])[H].O=S([O-])[O-] |
||
| InChIKey = |
| InChIKey = |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/2H3N.H2O3S/c;;1-4(2)3/h2*1H3;(H2,1,2,3) |
| StdInChI = 1S/2H3N.H2O3S/c;;1-4(2)3/h2*1H3;(H2,1,2,3) |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = PQUCIEFHOVEZAU-UHFFFAOYSA-N |
| StdInChIKey = PQUCIEFHOVEZAU-UHFFFAOYSA-N |
||
| SMILES1 = [O-]S([O-])=O.[NH4+].[NH4+] |
| SMILES1 = [O-]S([O-])=O.[NH4+].[NH4+] |
||
| Line 18: | Line 21: | ||
| UNNumber = |
| UNNumber = |
||
| RTECS = |
| RTECS = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| |
| ChemSpiderID = 23404 |
||
}} |
}} |
||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
Revision as of 14:21, 29 November 2010
| |
| Names | |
|---|---|
| IUPAC name
Ammonium sulfite
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
| ECHA InfoCard | 100.030.428 |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| (NH4)2SO3 | |
| Molar mass | 134.16 g/mol |
| Appearance | colourless [1] hygroscopic |
| Melting point | 65 °C, decomposes[1] |
| 35 g/100 mL[1] | |
| Related compounds | |
Other anions
|
Ammonium hydroxide |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Ammonium sulfite is a salt with the chemical formula (NH4)2SO3.
Preparation
Ammonium sulfite can be prepared by the reaction of ammonia with sulfur dioxide in aqueous solution:
- NH3 + SO2 + H2O → (NH4)2SO3
Chemical Properties
Ammonium sulfite is a reducing agent.[2] It emits sulfur dioxide and oxides of nitrogen upon heating to decomposition.