Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID StdInChI StdInChIKey SMILES1. |
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi |
||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| verifiedrevid = 399510638 |
|||
| Name = Apiforol |
| Name = Apiforol |
||
| ImageFile = Apiforol.PNG |
| ImageFile = Apiforol.PNG |
||
| Line 6: | Line 7: | ||
| IUPACName = (2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol |
| IUPACName = (2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol |
||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| |
| ChemSpiderID = 391780 |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C15H14O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,12-13,16-19H,7H2/t12?,13-/m0/s1 |
| StdInChI = 1S/C15H14O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,12-13,16-19H,7H2/t12?,13-/m0/s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = RPKUCYSGAXIESU-ABLWVSNPSA-N |
| StdInChIKey = RPKUCYSGAXIESU-ABLWVSNPSA-N |
||
| SMILES1 = Oc1ccc(cc1)[C@H]3Oc2cc(O)cc(O)c2C(O)C3 |
| SMILES1 = Oc1ccc(cc1)[C@H]3Oc2cc(O)cc(O)c2C(O)C3 |
||
Revision as of 13:05, 29 November 2010
| |
| Names | |
|---|---|
| IUPAC name
(2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C15H14O5 | |
| Molar mass | 274.26 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Apiforol is a chemical compound belonging to the flavan-4ol class of flavonoids.
Metabolism
(2S)-flavan-4-ol:NADP+ 4-oxidoreductase (flavanone 4-reductase[1]) is an enzyme transforming Naringenin into apiforol[2]. This enzyme can be found in Columnea hybrida, in Malus domestica, in Pyrus communis, in Sinningia cardinalis, and in Zea mays[1].