Content deleted Content added
m 443638 |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID StdInChI StdInChIKey SMILES1. |
||
Line 6: | Line 6: | ||
| IUPACName = (2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol |
| IUPACName = (2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol |
||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| |
| ChemSpiderID = 391780 |
||
| StdInChI = 1S/C15H14O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,12-13,16-19H,7H2/t12?,13-/m0/s1 |
|||
| StdInChIKey = RPKUCYSGAXIESU-ABLWVSNPSA-N |
|||
| SMILES1 = Oc1ccc(cc1)[C@H]3Oc2cc(O)cc(O)c2C(O)C3 |
|||
| CASNo = 55167-29-8 |
|||
| PubChem = 443638 |
| PubChem = 443638 |
||
| SMILES = C1C(C2=C(C=C(C=C2OC1C3=CC=C(C=C3)O)O)O)O |
| SMILES = C1C(C2=C(C=C(C=C2OC1C3=CC=C(C=C3)O)O)O)O |
Revision as of 12:54, 29 November 2010
Names | |
---|---|
IUPAC name
(2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol
| |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C15H14O5 | |
Molar mass | 274.26 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Apiforol is a chemical compound belonging to the flavan-4ol class of flavonoids.
Metabolism
(2S)-flavan-4-ol:NADP+ 4-oxidoreductase (flavanone 4-reductase[1]) is an enzyme transforming Naringenin into apiforol[2]. This enzyme can be found in Columnea hybrida, in Malus domestica, in Pyrus communis, in Sinningia cardinalis, and in Zea mays[1].