Content deleted Content added
m robot Adding: ja:ジフェニルシアノアルシン |
Plasmic Physics (talk | contribs) No edit summary |
||
| Line 1: | Line 1: | ||
{{ |
{{Chembox |
||
| ImageFile = Clark 2.svg |
| ImageFile = Clark 2.svg |
||
| ImageSize = |
| ImageSize = 244 |
||
| ImageName = Structural formula of diphenylcyanoarsine |
|||
| |
| PIN = Di(phenyl)arsanylformonitrile |
||
| OtherNames = Diphenylcyanoarsine<br/> Clark 2<br/> Diphenylarsine cyanide<br/> Diphenylarsinous cyanide<br/> Diphenylarsinecarbonitrile<br/> Arsinous cyanide, diphenyl-<br/> Arsinecarbonitrile, diphenyl-<br/> EINECS 245-716-6<br/> LS-193021 |
|||
| SystematicName = Diphenylarsanecarbonitrile |
|||
| OtherNames = Clark 2<br /> |
|||
Diphenylarsinecarbonitrile<br /> |
|||
Diphenylarsine cyanide<br /> |
|||
Diphenylarsinous cyanide<br /> |
|||
Diphenylcyanoarsine<br /> |
|||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| |
| CASNo = 23525-22-6 |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| |
| PubChem = 64506 |
||
| ⚫ | |||
| PubChem_Ref = {{Pubchemcite|correct|PubChem}} |
|||
| ⚫ | |||
| ChemSpiderID = 58070 |
|||
}} |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| EINECS = 245-716-6 |
|||
| MeSHName = Clark+2 |
|||
| ⚫ | |||
| SMILES1 = N#C[As](C1=CC=CC=C1)C1=CC=CC=C1 |
|||
| StdInChI = 1S/C13H10AsN/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| ⚫ | |||
| StdInChIKey = BDHNJKLLVSRGDK-UHFFFAOYSA-N |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}}} |
|||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
| C = 13 |
|||
| Formula = C<sub>13</sub>H<sub>10</sub>AsN |
|||
| H = 10 |
|||
| ⚫ | |||
| As = 1 |
|||
| N = 1 |
|||
| ⚫ | |||
}} |
}} |
||
'''Diphenylcyanoarsine''', also called CLARK 2 ([[Cyanide]]-[[Arsenic]] Kampfstoff) by the Germans, was discovered in 1918 by Sturniolo and Bellinzoni<ref>Sturniolo, G. und Bellinzoni , G. (1919); ''Boll. chim. pharm.'', 58, 409–410</ref> and shortly thereafter used like the related [[Diphenylchlorarsine|Clark 1]] gas by the Germans for chemical warfare in the [[First World War]]. The substance forms colourless, garlic-smelling crystals and causes nausea, vomiting and headaches. It can subsequently lead to e.g. [[pulmonary oedema]] (fluid on the lungs). |
'''Diphenylcyanoarsine''', also called CLARK 2 ([[Cyanide]]-[[Arsenic]] Kampfstoff) by the Germans, was discovered in 1918 by Sturniolo and Bellinzoni<ref>Sturniolo, G. und Bellinzoni , G. (1919); ''Boll. chim. pharm.'', 58, 409–410</ref> and shortly thereafter used like the related [[Diphenylchlorarsine|Clark 1]] gas by the Germans for chemical warfare in the [[First World War]]. The substance forms colourless, garlic-smelling crystals and causes nausea, vomiting and headaches. It can subsequently lead to e.g. [[pulmonary oedema]] (fluid on the lungs). |
||
Revision as of 08:42, 29 November 2010
| |
| Names | |
|---|---|
| Preferred IUPAC name
Di(phenyl)arsanylformonitrile | |
| Systematic IUPAC name
Diphenylarsanecarbonitrile | |
| Other names
Clark 2
Diphenylarsinecarbonitrile | |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
| ECHA InfoCard | 100.041.545 |
| EC Number |
|
| MeSH | Clark+2 |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C13H10AsN | |
| Molar mass | 255.002920742 g mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Diphenylcyanoarsine, also called CLARK 2 (Cyanide-Arsenic Kampfstoff) by the Germans, was discovered in 1918 by Sturniolo and Bellinzoni[1] and shortly thereafter used like the related Clark 1 gas by the Germans for chemical warfare in the First World War. The substance forms colourless, garlic-smelling crystals and causes nausea, vomiting and headaches. It can subsequently lead to e.g. pulmonary oedema (fluid on the lungs).
See also
References
- ^ Sturniolo, G. und Bellinzoni , G. (1919); Boll. chim. pharm., 58, 409–410