The complete data for Cysteine () | ||||||||||||||||
General information Chemical formula: C3H7NO2S Molar mass: 121.16 g·mol−1 Systematic name: (2R)-2-amino-3-sulfanyl-propanoic acid Abbreviations: C, Cys Synonyms: 2-amino-3-mercaptopropanoic acid 2-amino-3-mercaptopropionic acid 2-amino-3-sulfanylpropanoic acid 3-mercaptoalanine AIDS{-}160777 CHEBI:15356 CHEMBANK2703 NSC 63864 NSC647530 NSC8746 Zystein | ||||||||||||||||
Database data | ||||||||||||||||
SMILES: SCC(N)C(=O)O InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/f/h5H
| ||||||||||||||||
Physical properties | ||||||||||||||||
| ||||||||||||||||
Hazard properties | ||||||||||||||||
| ||||||||||||||||
Chemical properties | ||||||||||||||||
| ||||||||||||||||
Pharmacological properties |
This box:
- Except where noted otherwise, data relate to Standard temperature and pressure.
- Reliability of data general note.