Cannabis Ruderalis

Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox va
Citation bot 1 (talk | contribs)
m [Pu408]Add: doi. You can use this bot yourself. Report bugs here.
Line 39: Line 39:
}}
}}


'''VCHSR''' is a drug used in scientific research which acts as a selective [[Antagonist (pharmacology)|antagonist]] of the [[cannabinoid receptor]] [[cannabinoid receptor 1|CB<sub>1</sub>]]. It is derived from the widely used CB<sub>1</sub> antagonist [[rimonabant]], and has similar potency and selectivity for the CB<sub>1</sub> receptor, but has been modified to remove the [[hydrogen bonding]] capability in the C-3 substituent region, which removes the [[inverse agonist]] effect that rimonabant produces at high doses, so that VCHSR instead acts as a [[neutral antagonist]], blocking the receptor but producing no physiological effect of its own.<ref>{{cite journal | last1 = Hurst | first1 = DP | last2 = Lynch | first2 = DL | last3 = Barnett-Norris | first3 = J | last4 = Hyatt | first4 = SM | last5 = Seltzman | first5 = HH | last6 = Zhong | first6 = M | last7 = Song | first7 = ZH | last8 = Nie | first8 = J | last9 = Lewis | first9 = D | title = N-(piperidin-1-yl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-1H-pyrazole-3-carboxamide (SR141716A) interaction with LYS 3.28(192) is crucial for its inverse agonism at the cannabinoid CB1 receptor | journal = Molecular pharmacology | volume = 62 | issue = 6 | pages = 1274–87 | year = 2002 | pmid = 12435794 }}</ref><ref>{{cite journal | last1 = Hurst | first1 = D | last2 = Umejiego | first2 = U | last3 = Lynch | first3 = D | last4 = Seltzman | first4 = H | last5 = Hyatt | first5 = S | last6 = Roche | first6 = M | last7 = McAllister | first7 = S | last8 = Fleischer | first8 = D | last9 = Kapur | first9 = A | title = Biarylpyrazole inverse agonists at the cannabinoid CB1 receptor: importance of the C-3 carboxamide oxygen/lysine3.28(192) interaction | journal = Journal of medicinal chemistry | volume = 49 | issue = 20 | pages = 5969–87 | year = 2006 | pmid = 17004712 | doi = 10.1021/jm060446b }}</ref>
'''VCHSR''' is a drug used in scientific research which acts as a selective [[Antagonist (pharmacology)|antagonist]] of the [[cannabinoid receptor]] [[cannabinoid receptor 1|CB<sub>1</sub>]]. It is derived from the widely used CB<sub>1</sub> antagonist [[rimonabant]], and has similar potency and selectivity for the CB<sub>1</sub> receptor, but has been modified to remove the [[hydrogen bonding]] capability in the C-3 substituent region, which removes the [[inverse agonist]] effect that rimonabant produces at high doses, so that VCHSR instead acts as a [[neutral antagonist]], blocking the receptor but producing no physiological effect of its own.<ref>{{cite journal | last1 = Hurst | first1 = DP | last2 = Lynch | first2 = DL | last3 = Barnett-Norris | first3 = J | last4 = Hyatt | first4 = SM | last5 = Seltzman | first5 = HH | last6 = Zhong | first6 = M | last7 = Song | first7 = ZH | last8 = Nie | first8 = J | last9 = Lewis | first9 = D | title = N-(piperidin-1-yl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-1H-pyrazole-3-carboxamide (SR141716A) interaction with LYS 3.28(192) is crucial for its inverse agonism at the cannabinoid CB1 receptor | journal = Molecular pharmacology | volume = 62 | issue = 6 | pages = 1274–87 | year = 2002 | pmid = 12435794 | doi = 10.1124/mol.62.6.1274 }}</ref><ref>{{cite journal | last1 = Hurst | first1 = D | last2 = Umejiego | first2 = U | last3 = Lynch | first3 = D | last4 = Seltzman | first4 = H | last5 = Hyatt | first5 = S | last6 = Roche | first6 = M | last7 = McAllister | first7 = S | last8 = Fleischer | first8 = D | last9 = Kapur | first9 = A | title = Biarylpyrazole inverse agonists at the cannabinoid CB1 receptor: importance of the C-3 carboxamide oxygen/lysine3.28(192) interaction | journal = Journal of medicinal chemistry | volume = 49 | issue = 20 | pages = 5969–87 | year = 2006 | pmid = 17004712 | doi = 10.1021/jm060446b }}</ref>


==References==
==References==

Revision as of 08:22, 21 October 2011

VCHSR
Identifiers
  • 5-(4-chlorophenyl)- 3-[(E)-2-cyclohexylethenyl]- 1-(2,4-dichlorophenyl)- 4-methyl- 1H-pyrazole
Chemical and physical data
FormulaC24H23Cl3N2
Molar mass445.811 g·mol−1
3D model (JSmol)
  • C4CCCCC4C=Cc(c(C)c1-c(cc3)ccc3Cl)nn1-c2ccc(Cl)cc2Cl
  (verify)

VCHSR is a drug used in scientific research which acts as a selective antagonist of the cannabinoid receptor CB1. It is derived from the widely used CB1 antagonist rimonabant, and has similar potency and selectivity for the CB1 receptor, but has been modified to remove the hydrogen bonding capability in the C-3 substituent region, which removes the inverse agonist effect that rimonabant produces at high doses, so that VCHSR instead acts as a neutral antagonist, blocking the receptor but producing no physiological effect of its own.[1][2]

References

  1. ^ Hurst, DP; Lynch, DL; Barnett-Norris, J; Hyatt, SM; Seltzman, HH; Zhong, M; Song, ZH; Nie, J; Lewis, D (2002). "N-(piperidin-1-yl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-1H-pyrazole-3-carboxamide (SR141716A) interaction with LYS 3.28(192) is crucial for its inverse agonism at the cannabinoid CB1 receptor". Molecular pharmacology. 62 (6): 1274–87. doi:10.1124/mol.62.6.1274. PMID 12435794.
  2. ^ Hurst, D; Umejiego, U; Lynch, D; Seltzman, H; Hyatt, S; Roche, M; McAllister, S; Fleischer, D; Kapur, A (2006). "Biarylpyrazole inverse agonists at the cannabinoid CB1 receptor: importance of the C-3 carboxamide oxygen/lysine3.28(192) interaction". Journal of medicinal chemistry. 49 (20): 5969–87. doi:10.1021/jm060446b. PMID 17004712.


Leave a Reply