Content deleted Content added
m r2.7.3) (Robot: Adding fa:۸-آنیلینونفتالن-۱-سولفونات |
added image of the sulfonate |
||
(One intermediate revision by the same user not shown) | |||
Line 2: | Line 2: | ||
{{chembox |
{{chembox |
||
| verifiedrevid = 443656014 |
| verifiedrevid = 443656014 |
||
|ImageFile= |
|ImageFile=8-Anilinonaphthalene-1-sulfonate.svg |
||
|ImageSize=200px |
|ImageSize=200px |
||
|IUPACName=8-(phenylamino)-1- |
|IUPACName=8-(phenylamino)-1-naphthalenesulfonate |
||
|OtherNames=Phenylperi acid |
|||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = C11326 |
| KEGG = C11326 |
||
| |
| StdInChI = 1S/C16H13NO3S/c18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13/h1-11,17H,(H,18,19,20)/p-1 |
||
| |
| StdInChIKey = FWEOQOXTVHGIFQ-UHFFFAOYSA-M |
||
⚫ | |||
| SMILES1 = c1ccc(cc1)Nc2cccc3c2c(ccc3)S(=O)(=O)O |
|||
⚫ | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 285527 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C16H13NO3S/c18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13/h1-11,17H,(H,18,19,20) |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = FWEOQOXTVHGIFQ-UHFFFAOYSA-N |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CASNo=82-76-8 |
|||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
⚫ | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 39708 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = DB04474 |
| DrugBank = DB04474 |
||
| SMILES = O |
| SMILES = [O-]S(=O)(=O)c2c1c(cccc1ccc2)Nc3ccccc3 |
||
}} |
}} |
||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
Revision as of 13:36, 22 June 2012
Names | |
---|---|
IUPAC name
8-(phenylamino)-1-naphthalenesulfonate
| |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
DrugBank | |
ECHA InfoCard | 100.001.308 |
KEGG | |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C16H13NO3S | |
Molar mass | 299.34 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
8-Anilinonaphthalene-1-sulfonate (ANS) is used as a fluorescent molecular probe.[1] Its permeability to mitochondrial membranes makes it particularly useful.[2]
References
- ^ Andras Malnasi-Csizmadia; György Hegyi; Ferenc Tölgyesi; Andrew G. Szent-Györgyi; and László Nyitray (1999). "Fluorescence measurements detect changes in scallop myosin regulatory domain". European Journal of Biochemistry. 261 (2): 452. doi:10.1046/j.1432-1327.1999.00290.x. PMID 10215856.
{{cite journal}}
: CS1 maint: multiple names: authors list (link) - ^ Gains N, Dawson AP (1975). "8-Anilinonaphthalene-1-sulphonate interaction with whole and disrupted mitochondria: a re-evaluation of the use of double-reciprocal plots in the derivation of binding parameters for fluorescent probes binding to mitochondrial membranes". Biochem. J. 148 (1): 157–60. PMC 1165518. PMID 1156395.
{{cite journal}}
: Unknown parameter|month=
ignored (help)