THC Science

Interfungin
	; Interfungin A
	; Interfungin B
	; Interfungin C
Identifiers
3D model (JSmol)	A: Interactive image; B: Interactive image; C: Interactive image;
PubChem CID	A: 54726789; B: 54718836; C: 54726790;
	SMILES A: CC(=O)/C=C(/C(=C\C1=CC(=C(C=C1)O)O)/C2=C(C=C(OC2=O)/C=C/C3=CC(=C(C=C3)O)O)O)\O; B: CC(=O)/C(=C\C1=CC(=C(C=C1)O)O)/C2=C(C=C(OC2=O)/C=C/C3=CC(=C(C=C3)O)O)O; C: COC(=O)/C(=C\C1=CC(=C(C=C1)O)O)/C2=C(C=C(OC2=O)/C=C/C3=CC(=C(C=C3)O)O)O;
Properties
Chemical formula	A: C25H20O9 ; B: C23H18O8 ; C: C23H18O9
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Interfungins are a group of chemical compounds isolated from fungi in the genus Phellinus which have NF-κB inhibitory activities.^[1]

References[edit]

^ Wu, Chang-Sheng; Lin, Zhao-Min; Wang, Li-Ning; Guo, Dong-Xiao; Wang, Shu-Qi; Liu, Yong-Qing; Yuan, Hui-Qing; Lou, Hong-Xiang (2011). "Phenolic compounds with NF-κB inhibitory effects from the fungus Phellinus baumii". Bioorganic & Medicinal Chemistry Letters. 21 (11): 3261–7. doi:10.1016/j.bmcl.2011.04.025. PMID 21531558.

Identifiers
Interfungin A
Interfungin B
Interfungin C
3D model (JSmol)	A: Interactive image B: Interactive image C: Interactive image
PubChem CID	A: 54726789 B: 54718836 C: 54726790
SMILES A: CC(=O)/C=C(/C(=C\C1=CC(=C(C=C1)O)O)/C2=C(C=C(OC2=O)/C=C/C3=CC(=C(C=C3)O)O)O)\O B: CC(=O)/C(=C\C1=CC(=C(C=C1)O)O)/C2=C(C=C(OC2=O)/C=C/C3=CC(=C(C=C3)O)O)O C: COC(=O)/C(=C\C1=CC(=C(C=C1)O)O)/C2=C(C=C(OC2=O)/C=C/C3=CC(=C(C=C3)O)O)O
Properties
Chemical formula	A: C₂₅H₂₀O₉ B: C₂₃H₁₈O₈ C: C₂₃H₁₈O₉
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references